| ![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description | 
|---|---|---|---|---|
| ![[PARENTDIR]](/icons/back.gif) | Parent Directory | - | ||
| ![[TXT]](/icons/text.gif) | balancing-chemical-equations_en_phet.html | 2022-12-21 10:21 | 1.6M | |
| ![[TXT]](/icons/text.gif) | balancing-chemical-equations_all_phet.html | 2022-12-21 10:21 | 2.0M | |
| ![[   ]](/icons/compressed.gif) | balancing-chemical-equations_all_phet.html.gz | 2022-12-21 10:21 | 552K | |
| ![[TXT]](/icons/text.gif) | balancing-chemical-equations_all_phet_debug.html | 2022-12-21 10:21 | 5.5M | |
| ![[TXT]](/icons/text.gif) | balancing-chemical-equations_all_iframe_phet.html | 2022-12-21 10:21 | 1.1K | |
| ![[TXT]](/icons/text.gif) | balancing-chemical-equations_en_iframe_phet.html | 2022-12-21 10:21 | 1.1K | |
| ![[   ]](/icons/unknown.gif) | dependencies.json | 2022-12-21 10:21 | 2.3K | |
| ![[IMG]](/icons/image2.gif) | balancing-chemical-equations-128.png | 2022-12-21 10:21 | 5.1K | |
| ![[IMG]](/icons/image2.gif) | balancing-chemical-equations-600.png | 2022-12-21 10:21 | 42K | |
| ![[IMG]](/icons/image2.gif) | balancing-chemical-equations-twitter-card.png | 2022-12-21 10:21 | 50K | |
| ![[DIR]](/icons/folder.gif) | xhtml/ | 2022-12-21 10:21 | - | |